CAS 951892-08-3

4-(2-Bromo-2-propen-1-yl)-1,2-dimethylbenzene

Description:

4-(2-Bromo-2-propen-1-yl)-1,2-dimethylbenzene, also known by its CAS number 951892-08-3, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two methyl groups and a propenyl group containing a bromine atom. This compound features a bromoalkene substituent that can participate in various chemical reactions, such as electrophilic addition and substitution due to the presence of the double bond. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis. The compound is likely to be a colorless to pale yellow liquid at room temperature, with a distinct aromatic odor typical of substituted benzenes. Its physical properties, such as boiling point and solubility, would be influenced by the substituents on the benzene ring. Additionally, the compound may exhibit interesting chemical behavior due to the steric and electronic effects of the methyl and bromo groups, making it relevant in fields such as medicinal chemistry and materials science.

Formula: C₁₁H₁₃Br

InChI: InChI=1S/C11H13Br/c1-8-4-5-11(6-9(8)2)7-10(3)12/h4-6H,3,7H2,1-2H3

InChI key: InChIKey=PNYZSVZHTKEMPC-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=CC(C)=C(C)C=C1

Synonyms:

• Benzene, 4-(2-bromo-2-propen-1-yl)-1,2-dimethyl-
• 4-(2-Bromo-2-propen-1-yl)-1,2-dimethylbenzene