CAS 951892-11-8

4-(3-Bromo-3-buten-1-yl)-1,2-dimethylbenzene

Description:

4-(3-Bromo-3-buten-1-yl)-1,2-dimethylbenzene, with the CAS number 951892-11-8, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromoalkene and two methyl groups. The presence of the bromo group introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The alkenyl substituent (3-buten-1-yl) contributes to its unsaturation, which can also participate in addition reactions. This compound is likely to exhibit hydrophobic properties due to its aromatic nature, influencing its solubility in organic solvents rather than in water. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of more complex molecules or as intermediates in pharmaceutical chemistry. Safety and handling precautions should be observed, as brominated compounds can pose health risks and environmental concerns. Overall, this compound's unique structure and reactivity profile make it of interest in both academic and industrial chemistry contexts.

Formula: C₁₂H₁₅Br

InChI: InChI=1S/C12H15Br/c1-9-4-6-12(8-10(9)2)7-5-11(3)13/h4,6,8H,3,5,7H2,1-2H3

InChI key: InChIKey=IKZDVRGUPJNKTI-UHFFFAOYSA-N

SMILES: C(CC(Br)=C)C1=CC(C)=C(C)C=C1

Synonyms:

• 4-(3-Bromo-3-buten-1-yl)-1,2-dimethylbenzene
• Benzene, 4-(3-bromo-3-buten-1-yl)-1,2-dimethyl-