CAS 951892-16-3
:Methanone, (3,5-dimethoxyphenyl)(3-iodophenyl)-
Description:
Methanone, (3,5-dimethoxyphenyl)(3-iodophenyl)-, also known by its CAS number 951892-16-3, is an organic compound characterized by its ketone functional group, specifically a methanone structure. This compound features a phenyl ring substituted with both methoxy groups and an iodine atom, which contributes to its unique chemical properties. The presence of the methoxy groups enhances the electron-donating characteristics of the phenyl ring, potentially influencing its reactivity and solubility in various solvents. The iodine substituent can introduce significant steric and electronic effects, making the compound of interest in various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further studies and evaluations of its properties and interactions.
Formula:C15H13IO3
InChI:InChI=1S/C15H13IO3/c1-18-13-7-11(8-14(9-13)19-2)15(17)10-4-3-5-12(16)6-10/h3-9H,1-2H3
InChI key:InChIKey=MQFFCCRQFVNJOF-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C2=CC(I)=CC=C2
Synonyms:- Methanone, (3,5-dimethoxyphenyl)(3-iodophenyl)-
- (3,5-Dimethoxyphenyl)-(3-iodophenyl)methanone
- 3,5-Dimethoxy-3′-iodobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.