CymitQuimica logo

CAS 951892-20-9

:

(3,5-Dimethoxyphenyl)(4-iodophenyl)methanone

Description:
(3,5-Dimethoxyphenyl)(4-iodophenyl)methanone, identified by its CAS number 951892-20-9, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a methanone moiety bonded to two distinct aromatic rings: one containing two methoxy groups at the 3 and 5 positions and the other bearing an iodine substituent at the para position. The presence of the methoxy groups enhances the compound's electron-donating properties, which can influence its reactivity and solubility in various solvents. The iodine atom, being a heavy halogen, can impart unique properties such as increased molecular weight and potential for halogen bonding. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and material science. Its synthesis typically involves reactions that form carbon-carbon bonds and may require specific conditions to ensure the stability of the functional groups. Overall, (3,5-Dimethoxyphenyl)(4-iodophenyl)methanone is a versatile compound with potential applications in various fields of research.
Formula:C15H13IO3
InChI:InChI=1S/C15H13IO3/c1-18-13-7-11(8-14(9-13)19-2)15(17)10-3-5-12(16)6-4-10/h3-9H,1-2H3
InChI key:InChIKey=VPIWYDYRVNXWOL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC(OC)=C1)C2=CC=C(I)C=C2
Synonyms:
  • Methanone, (3,5-dimethoxyphenyl)(4-iodophenyl)-
  • (3,5-Dimethoxyphenyl)(4-iodophenyl)methanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.