CAS 951892-24-3

(3,5-Dimethoxyphenyl)[4-(1,1-dimethylethyl)phenyl]methanone

Description:

(3,5-Dimethoxyphenyl)[4-(1,1-dimethylethyl)phenyl]methanone, with the CAS number 951892-24-3, is an organic compound characterized by its complex structure featuring a ketone functional group. This compound consists of a methanone moiety bonded to two distinct aromatic rings: one containing methoxy substituents at the 3 and 5 positions, and the other bearing a bulky tert-butyl group at the para position. The presence of methoxy groups typically enhances the compound's solubility in organic solvents and can influence its reactivity and interaction with biological systems. The tert-butyl group contributes to steric hindrance, which may affect the compound's conformational flexibility and overall stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic reactions, and its properties can be further explored through various analytical techniques such as NMR, IR spectroscopy, and mass spectrometry.

Formula: C₁₉H₂₂O₃

InChI: InChI=1S/C19H22O3/c1-19(2,3)15-8-6-13(7-9-15)18(20)14-10-16(21-4)12-17(11-14)22-5/h6-12H,1-5H3

InChI key: InChIKey=XJCZAJCGNWFBPD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC(OC)=C1)C2=CC=C(C(C)(C)C)C=C2

Synonyms:

• Methanone, (3,5-dimethoxyphenyl)[4-(1,1-dimethylethyl)phenyl]-
• (3,5-Dimethoxyphenyl)[4-(1,1-dimethylethyl)phenyl]methanone

4-tert-Butyl-3′,5′-dimethoxybenzophenone

CAS: 951892-24-3

Formula: C₁₉H₂₂O₃

Purity: 97.0%

Molecular weight: 298.382

Ref: 10-F202020