CymitQuimica logo

CAS 951892-25-4

:

1-(3-Chloro-3-buten-1-yl)-3,5-dimethylbenzene

Description:
1-(3-Chloro-3-buten-1-yl)-3,5-dimethylbenzene, identified by its CAS number 951892-25-4, is an organic compound characterized by a substituted benzene ring. The structure features a 3-chloro-3-buten-1-yl group attached to a dimethyl-substituted benzene, which contributes to its unique chemical properties. This compound is likely to exhibit moderate to high reactivity due to the presence of the vinyl chloride moiety, making it susceptible to nucleophilic attack and polymerization reactions. The dimethyl groups on the benzene ring can influence its steric and electronic properties, potentially affecting its solubility and reactivity in various solvents. Additionally, the presence of chlorine can impart specific characteristics such as increased polarity and potential for further chemical transformations. Overall, this compound may find applications in organic synthesis, particularly in the development of more complex molecules or materials. However, safety and handling precautions should be observed due to the potential hazards associated with chlorinated compounds.
Formula:C12H15Cl
InChI:InChI=1S/C12H15Cl/c1-9-6-10(2)8-12(7-9)5-4-11(3)13/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=OOGZBMOXZAQTSA-UHFFFAOYSA-N
SMILES:C(CC(=C)Cl)C1=CC(C)=CC(C)=C1
Synonyms:
  • Benzene, 1-(3-chloro-3-buten-1-yl)-3,5-dimethyl-
  • 1-(3-Chloro-3-buten-1-yl)-3,5-dimethylbenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.