CAS 951892-27-6

2-(3-Chloro-3-buten-1-yl)-1,4-difluorobenzene

Description:

2-(3-Chloro-3-buten-1-yl)-1,4-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluorobenzene ring and a chloroalkene substituent. The presence of two fluorine atoms on the benzene ring enhances its reactivity and polarity, making it useful in various chemical applications. The chloroalkene moiety contributes to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is likely to exhibit moderate to high volatility due to its relatively low molecular weight and the presence of the alkene group, which can also influence its reactivity in electrophilic addition reactions. Additionally, the chlorine atom may impart specific properties such as increased lipophilicity and potential biological activity. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 2-(3-Chloro-3-buten-1-yl)-1,4-difluorobenzene represents a versatile compound in the field of synthetic organic chemistry.

Formula: C₁₀H₉ClF₂

InChI: InChI=1S/C10H9ClF2/c1-7(11)2-3-8-6-9(12)4-5-10(8)13/h4-6H,1-3H2

InChI key: InChIKey=FCGGTZVDRGJWNL-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)C1=C(F)C=CC(F)=C1

Synonyms:

• Benzene, 2-(3-chloro-3-buten-1-yl)-1,4-difluoro-
• 2-(3-Chloro-3-buten-1-yl)-1,4-difluorobenzene