CymitQuimica logo

CAS 951892-35-6

:

1,4-Difluoro-2-(3-methyl-3-buten-1-yl)benzene

Description:
1,4-Difluoro-2-(3-methyl-3-buten-1-yl)benzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two fluorine atoms and a side chain containing a branched alkene. The presence of the difluoro groups indicates that the compound may exhibit unique reactivity and polarity compared to its non-fluorinated counterparts. The 3-methyl-3-buten-1-yl substituent introduces a degree of steric hindrance and contributes to the compound's overall hydrophobic character. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its specific conditions. Its fluorinated nature may enhance its stability and resistance to degradation, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the alkene moiety suggests potential for further chemical transformations, such as polymerization or addition reactions. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C11H12F2
InChI:InChI=1S/C11H12F2/c1-8(2)3-4-9-7-10(12)5-6-11(9)13/h5-7H,1,3-4H2,2H3
InChI key:InChIKey=GWYNQXBTAAXASU-UHFFFAOYSA-N
SMILES:C(CC(C)=C)C1=C(F)C=CC(F)=C1
Synonyms:
  • Benzene, 1,4-difluoro-2-(3-methyl-3-buten-1-yl)-
  • 1,4-Difluoro-2-(3-methyl-3-buten-1-yl)benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.