CymitQuimica logo

CAS 951892-45-8

:

1-(2-Bromo-2-propen-1-yl)-2,3-dichlorobenzene

Description:
1-(2-Bromo-2-propen-1-yl)-2,3-dichlorobenzene, with the CAS number 951892-45-8, is an organic compound characterized by its unique structure, which includes a dichlorobenzene ring substituted with a propenyl group that contains a bromine atom. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased stability and potential reactivity due to the presence of the bromine and chlorine substituents. The propenyl group introduces unsaturation, which can lead to additional reactivity, particularly in electrophilic addition reactions. The presence of multiple halogens can also influence the compound's physical properties, such as solubility and boiling point, making it more polar compared to non-halogenated analogs. Additionally, the compound may have applications in organic synthesis or as an intermediate in the production of other chemical entities. Safety considerations should be taken into account due to the potential toxicity and environmental impact of halogenated compounds.
Formula:C9H7BrCl2
InChI:InChI=1S/C9H7BrCl2/c1-6(10)5-7-3-2-4-8(11)9(7)12/h2-4H,1,5H2
InChI key:InChIKey=GFDHOUFUMHWWIH-UHFFFAOYSA-N
SMILES:C(C(Br)=C)C1=C(Cl)C(Cl)=CC=C1
Synonyms:
  • 1-(2-Bromo-2-propen-1-yl)-2,3-dichlorobenzene
  • Benzene, 1-(2-bromo-2-propen-1-yl)-2,3-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.