CAS 951892-52-7

2,4-Dichloro-1-(2-chloro-2-propen-1-yl)benzene

Description:

2,4-Dichloro-1-(2-chloro-2-propen-1-yl)benzene, identified by its CAS number 951892-52-7, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and a propenyl group. The presence of multiple chlorine atoms contributes to its chemical stability and hydrophobic nature, making it less soluble in water but more soluble in organic solvents. This compound is typically used in various applications, including as an intermediate in the synthesis of other chemicals and potentially in agrochemical formulations. Its structure suggests it may exhibit biological activity, which could be relevant for its use in pest control or herbicide formulations. However, the chlorine substituents also raise concerns regarding environmental persistence and toxicity, necessitating careful handling and regulation. Overall, 2,4-Dichloro-1-(2-chloro-2-propen-1-yl)benzene is a compound of interest in both industrial and environmental chemistry contexts.

Formula: C₉H₇Cl₃

InChI: InChI=1S/C9H7Cl3/c1-6(10)4-7-2-3-8(11)5-9(7)12/h2-3,5H,1,4H2

InChI key: InChIKey=YGRGDPHCZGUJJC-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• 2,4-Dichloro-1-(2-chloro-2-propen-1-yl)benzene
• Benzene, 2,4-dichloro-1-(2-chloro-2-propen-1-yl)-