CAS 951892-57-2
:4-(2-Chloro-2-propen-1-yl)-1,2-difluorobenzene
Description:
4-(2-Chloro-2-propen-1-yl)-1,2-difluorobenzene, with the CAS number 951892-57-2, is an organic compound characterized by its unique structure that includes a difluorobenzene ring and a vinyl chloride substituent. This compound features two fluorine atoms attached to the benzene ring, which can influence its reactivity and physical properties, such as polarity and boiling point. The presence of the 2-chloro-2-propen-1-yl group introduces a reactive double bond, making it susceptible to various chemical reactions, including polymerization and substitution reactions. The compound is likely to be a colorless to pale yellow liquid or solid, depending on temperature and purity. Its applications may span across fields such as agrochemicals, pharmaceuticals, or materials science, particularly in the synthesis of more complex molecules. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Proper handling and disposal procedures are essential to mitigate any potential hazards associated with this substance.
Formula:C9H7ClF2
InChI:InChI=1S/C9H7ClF2/c1-6(10)4-7-2-3-8(11)9(12)5-7/h2-3,5H,1,4H2
InChI key:InChIKey=QRXHEAMENJWDGB-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC(F)=C(F)C=C1
Synonyms:- 4-(2-Chloro-2-propen-1-yl)-1,2-difluorobenzene
- Benzene, 4-(2-chloro-2-propen-1-yl)-1,2-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.