CymitQuimica logo

CAS 951892-70-9

:

2-(3-Buten-1-yl)-1,4-dichlorobenzene

Description:
2-(3-Buten-1-yl)-1,4-dichlorobenzene, identified by its CAS number 951892-70-9, is an organic compound characterized by its aromatic structure and the presence of both butenyl and dichlorobenzene functional groups. This compound features a dichlorobenzene ring, which contributes to its stability and hydrophobic nature, while the butenyl group introduces unsaturation and potential reactivity. Typically, compounds of this nature exhibit moderate to low solubility in water but are more soluble in organic solvents due to their hydrophobic characteristics. The presence of chlorine atoms enhances the compound's electron-withdrawing properties, which can influence its reactivity in various chemical reactions, such as electrophilic substitution or nucleophilic attack. Additionally, the butenyl group may participate in reactions typical of alkenes, such as polymerization or addition reactions. Overall, 2-(3-Buten-1-yl)-1,4-dichlorobenzene is of interest in synthetic organic chemistry and may have applications in materials science or as an intermediate in the synthesis of more complex molecules.
Formula:C10H10Cl2
InChI:InChI=1S/C10H10Cl2/c1-2-3-4-8-7-9(11)5-6-10(8)12/h2,5-7H,1,3-4H2
InChI key:InChIKey=URSIIJHDACKFGY-UHFFFAOYSA-N
SMILES:C(CC=C)C1=C(Cl)C=CC(Cl)=C1
Synonyms:
  • 2-(3-Buten-1-yl)-1,4-dichlorobenzene
  • Benzene, 2-(3-buten-1-yl)-1,4-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.