CymitQuimica logo

CAS 951892-76-5

:

1,4-Dichloro-2-(3-chloro-3-buten-1-yl)benzene

Description:
1,4-Dichloro-2-(3-chloro-3-buten-1-yl)benzene is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two chlorine atoms and a side chain containing a chlorinated alkene. The presence of the dichloro substituents indicates that the compound has potential applications in various chemical reactions, particularly in synthesis and as an intermediate in organic chemistry. The chlorinated side chain contributes to its reactivity and may influence its physical properties, such as solubility and boiling point. This compound is likely to exhibit moderate to high stability under standard conditions, but it may undergo reactions typical of chlorinated compounds, such as nucleophilic substitution or elimination reactions. Additionally, due to the presence of chlorine atoms, it may pose environmental and health concerns, necessitating careful handling and disposal. Overall, 1,4-Dichloro-2-(3-chloro-3-buten-1-yl)benzene is a notable compound in the realm of synthetic organic chemistry, with potential implications in various industrial applications.
Formula:C10H9Cl3
InChI:InChI=1S/C10H9Cl3/c1-7(11)2-3-8-6-9(12)4-5-10(8)13/h4-6H,1-3H2
InChI key:InChIKey=UKMQPBJUGKHHKH-UHFFFAOYSA-N
SMILES:C(CC(=C)Cl)C1=C(Cl)C=CC(Cl)=C1
Synonyms:
  • 1,4-Dichloro-2-(3-chloro-3-buten-1-yl)benzene
  • Benzene, 1,4-dichloro-2-(3-chloro-3-buten-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.