CymitQuimica logo

CAS 951892-87-8

:

5-(2-Chloro-2-propen-1-yl)-1,2,3-trifluorobenzene

Description:
5-(2-Chloro-2-propen-1-yl)-1,2,3-trifluorobenzene is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and a vinyl chloride substituent. The presence of three fluorine atoms on the benzene ring significantly influences its chemical properties, enhancing its reactivity and lipophilicity. This compound is likely to exhibit a high degree of stability due to the aromatic nature of the benzene ring, while the vinyl chloride moiety introduces potential for further chemical reactions, such as polymerization or substitution reactions. The chlorine atom contributes to the compound's electrophilic character, making it a candidate for various synthetic applications in organic chemistry. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's behavior in biological systems and its interactions with other chemicals. Overall, 5-(2-Chloro-2-propen-1-yl)-1,2,3-trifluorobenzene is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science.
Formula:C9H6ClF3
InChI:InChI=1S/C9H6ClF3/c1-5(10)2-6-3-7(11)9(13)8(12)4-6/h3-4H,1-2H2
InChI key:InChIKey=KYDHSJBBDVSCGY-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC(F)=C(F)C(F)=C1
Synonyms:
  • Benzene, 5-(2-chloro-2-propen-1-yl)-1,2,3-trifluoro-
  • 5-(2-Chloro-2-propen-1-yl)-1,2,3-trifluorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.