CymitQuimica logo

CAS 951892-88-9

:

1,3-Dichloro-2-(3-chloro-3-buten-1-yl)benzene

Description:
1,3-Dichloro-2-(3-chloro-3-buten-1-yl)benzene, with the CAS number 951892-88-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and a side chain containing a 3-chloro-3-buten-1-yl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits properties common to chlorinated aromatic compounds, such as potential volatility and hydrophobicity. The presence of multiple chlorine substituents can influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, due to its chlorinated nature, it may possess biological activity, which could be relevant in fields such as agrochemicals or pharmaceuticals. Safety considerations are important, as chlorinated compounds can be toxic and environmentally persistent. Proper handling and disposal methods should be employed to mitigate any potential hazards associated with this substance.
Formula:C10H9Cl3
InChI:InChI=1S/C10H9Cl3/c1-7(11)5-6-8-9(12)3-2-4-10(8)13/h2-4H,1,5-6H2
InChI key:InChIKey=APYOCMMXPKIBCC-UHFFFAOYSA-N
SMILES:C(CC(=C)Cl)C1=C(Cl)C=CC=C1Cl
Synonyms:
  • 1,3-Dichloro-2-(3-chloro-3-buten-1-yl)benzene
  • Benzene, 1,3-dichloro-2-(3-chloro-3-buten-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.