CymitQuimica logo

CAS 951892-91-4

:

2-(3-Bromo-3-buten-1-yl)-1,3-dichlorobenzene

Description:
2-(3-Bromo-3-buten-1-yl)-1,3-dichlorobenzene is an organic compound characterized by its unique structure, which includes a dichlorobenzene ring and a bromoalkene substituent. The presence of the dichlorobenzene moiety indicates that the compound has two chlorine atoms attached to the benzene ring, which can influence its reactivity and physical properties, such as solubility and boiling point. The bromoalkene group contributes to the compound's potential for undergoing various chemical reactions, including nucleophilic substitutions and additions. This compound may exhibit moderate to high lipophilicity due to the aromatic and halogenated components, affecting its behavior in biological systems and environmental contexts. Additionally, the presence of bromine and chlorine atoms suggests that it may have specific applications in fields such as materials science, pharmaceuticals, or agrochemicals, although its exact uses would depend on further research into its reactivity and toxicity. Safety precautions should be taken when handling this compound due to the presence of halogens, which can pose health risks.
Formula:C10H9BrCl2
InChI:InChI=1S/C10H9BrCl2/c1-7(11)5-6-8-9(12)3-2-4-10(8)13/h2-4H,1,5-6H2
InChI key:InChIKey=ZGYNVCNRSLOMBF-UHFFFAOYSA-N
SMILES:C(CC(Br)=C)C1=C(Cl)C=CC=C1Cl
Synonyms:
  • Benzene, 2-(3-bromo-3-buten-1-yl)-1,3-dichloro-
  • 2-(3-Bromo-3-buten-1-yl)-1,3-dichlorobenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.