CAS 951893-06-4
:1,2-Dichloro-4-(2-methyl-2-propen-1-yl)benzene
Description:
1,2-Dichloro-4-(2-methyl-2-propen-1-yl)benzene, identified by its CAS number 951893-06-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and a propenyl group. The presence of the dichloro substituents indicates that the compound has potential applications in various chemical reactions, particularly in synthesis and as an intermediate in organic chemistry. Its propenyl group contributes to its reactivity, making it a candidate for further transformations, such as polymerization or addition reactions. The compound is likely to be a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Due to the chlorine atoms, it may also exhibit some degree of toxicity and environmental persistence, necessitating careful handling and disposal. Overall, 1,2-Dichloro-4-(2-methyl-2-propen-1-yl)benzene is of interest in both industrial and research contexts, particularly in the development of new materials and chemical processes.
Formula:C10H10Cl2
InChI:InChI=1S/C10H10Cl2/c1-7(2)5-8-3-4-9(11)10(12)6-8/h3-4,6H,1,5H2,2H3
InChI key:InChIKey=BYEPUSVEXPCAKZ-UHFFFAOYSA-N
SMILES:C(C(C)=C)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- Benzene, 1,2-dichloro-4-(2-methyl-2-propen-1-yl)-
- 1,2-Dichloro-4-(2-methyl-2-propen-1-yl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.