CymitQuimica logo

CAS 951893-20-2

:

1-(2-Chloro-2-propen-1-yl)-2,4,5-trimethylbenzene

Description:
1-(2-Chloro-2-propen-1-yl)-2,4,5-trimethylbenzene, also known by its CAS number 951893-20-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple alkyl groups and a chloroalkene moiety. The presence of the chloro group introduces reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitution or elimination reactions. The trimethyl groups contribute to the compound's hydrophobic nature and influence its physical properties, such as boiling and melting points. This compound may exhibit distinct odor characteristics typical of aromatic compounds and can be used in synthetic organic chemistry as an intermediate or building block for more complex molecules. Its reactivity and structural features suggest potential applications in the fields of pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research and development. Safety data should be consulted to understand its handling and toxicity profile.
Formula:C12H15Cl
InChI:InChI=1S/C12H15Cl/c1-8-5-10(3)12(6-9(8)2)7-11(4)13/h5-6H,4,7H2,1-3H3
InChI key:InChIKey=ARAABOJOISXKLH-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=C(C)C=C(C)C(C)=C1
Synonyms:
  • 1-(2-Chloro-2-propen-1-yl)-2,4,5-trimethylbenzene
  • Benzene, 1-(2-chloro-2-propen-1-yl)-2,4,5-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.