CAS 951893-23-5

1-(2-Bromo-2-propen-1-yl)-2,4,5-trimethylbenzene

Description:

1-(2-Bromo-2-propen-1-yl)-2,4,5-trimethylbenzene, identified by its CAS number 951893-23-5, is an organic compound that features a brominated propenyl group attached to a trimethyl-substituted benzene ring. This compound is characterized by its complex structure, which includes a bromine atom that enhances its reactivity, particularly in electrophilic substitution reactions. The presence of multiple methyl groups on the benzene ring contributes to its hydrophobic nature and can influence its physical properties, such as boiling point and solubility. Additionally, the propenyl group introduces a site for potential polymerization or further chemical transformations. This compound may be of interest in various fields, including organic synthesis and materials science, due to its unique structural features and potential applications in creating more complex molecules or materials. Safety and handling precautions should be observed, as brominated compounds can pose health risks and environmental concerns.

Formula: C₁₂H₁₅Br

InChI: InChI=1S/C12H15Br/c1-8-5-10(3)12(6-9(8)2)7-11(4)13/h5-6H,4,7H2,1-3H3

InChI key: InChIKey=QPQIXEPNVOCCSH-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=C(C)C=C(C)C(C)=C1

Synonyms:

• 1-(2-Bromo-2-propen-1-yl)-2,4,5-trimethylbenzene
• Benzene, 1-(2-bromo-2-propen-1-yl)-2,4,5-trimethyl-