CAS 951893-32-6
:1-(3-Buten-1-yl)-2,4-difluorobenzene
Description:
1-(3-Buten-1-yl)-2,4-difluorobenzene is an organic compound characterized by its unique structure, which includes a butenyl group attached to a difluorobenzene ring. The presence of two fluorine atoms at the 2 and 4 positions of the benzene ring significantly influences its chemical properties, including increased electronegativity and potential reactivity. This compound is likely to exhibit a range of physical properties such as moderate volatility and solubility in organic solvents, typical of aromatic compounds. The butenyl group introduces unsaturation, which can lead to additional reactivity, particularly in electrophilic addition reactions. The difluorobenzene moiety may also enhance the compound's stability and alter its interaction with biological systems, making it of interest in various fields, including materials science and medicinal chemistry. Overall, 1-(3-Buten-1-yl)-2,4-difluorobenzene represents a versatile structure with potential applications in synthetic chemistry and the development of functional materials.
Formula:C10H10F2
InChI:InChI=1S/C10H10F2/c1-2-3-4-8-5-6-9(11)7-10(8)12/h2,5-7H,1,3-4H2
InChI key:InChIKey=PPFIGPBGQGDIPA-UHFFFAOYSA-N
SMILES:C(CC=C)C1=C(F)C=C(F)C=C1
Synonyms:- Benzene, 1-(3-buten-1-yl)-2,4-difluoro-
- 1-(3-Buten-1-yl)-2,4-difluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.