CymitQuimica logo

CAS 951893-40-6

:

1-(3-Chloro-3-buten-1-yl)-2,4-difluorobenzene

Description:
1-(3-Chloro-3-buten-1-yl)-2,4-difluorobenzene is an organic compound characterized by its unique structure, which includes a difluorobenzene ring and a chloroalkene side chain. The presence of two fluorine atoms on the benzene ring enhances its reactivity and polarity, making it useful in various chemical applications. The chloroalkene moiety contributes to its potential as a reactive intermediate in organic synthesis. This compound is likely to exhibit moderate to high volatility due to its relatively low molecular weight and the presence of the alkene group. Additionally, the chlorine and fluorine substituents can influence its physical properties, such as solubility and boiling point, as well as its behavior in chemical reactions. Safety considerations are important, as halogenated compounds can pose environmental and health risks. Overall, 1-(3-Chloro-3-buten-1-yl)-2,4-difluorobenzene is a compound of interest in the fields of synthetic organic chemistry and materials science.
Formula:C10H9ClF2
InChI:InChI=1S/C10H9ClF2/c1-7(11)2-3-8-4-5-9(12)6-10(8)13/h4-6H,1-3H2
InChI key:InChIKey=JRGYRHQPVVXVBV-UHFFFAOYSA-N
SMILES:C(CC(=C)Cl)C1=C(F)C=C(F)C=C1
Synonyms:
  • 1-(3-Chloro-3-buten-1-yl)-2,4-difluorobenzene
  • Benzene, 1-(3-chloro-3-buten-1-yl)-2,4-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.