CAS 951893-41-7

4-Butyl-α,α-dimethyl-γ-oxobenzenebutanoic acid

Description:

4-Butyl-α,α-dimethyl-γ-oxobenzenebutanoic acid, identified by its CAS number 951893-41-7, is a synthetic organic compound characterized by its complex structure, which includes a butyl group and multiple methyl groups attached to a benzene ring. This compound features a γ-oxobutanoic acid moiety, indicating the presence of a ketone functional group adjacent to a carboxylic acid. The presence of these functional groups suggests that it may exhibit both acidic and potentially reactive properties, making it of interest in various chemical applications. The butyl group contributes to its hydrophobic characteristics, while the polar carboxylic acid group enhances its solubility in polar solvents. This compound may be utilized in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. Its specific reactivity and applications would depend on the context of its use, including potential interactions with other chemical species. As with any chemical, safety data and handling precautions should be reviewed before use.

Formula: C₁₆H₂₂O₃

InChI: InChI=1S/C16H22O3/c1-4-5-6-12-7-9-13(10-8-12)14(17)11-16(2,3)15(18)19/h7-10H,4-6,11H2,1-3H3,(H,18,19)

InChI key: InChIKey=UHRHQEDZAQNGKZ-UHFFFAOYSA-N

SMILES: C(CC(C(O)=O)(C)C)(=O)C1=CC=C(CCCC)C=C1

Synonyms:

• 4-Butyl-α,α-dimethyl-γ-oxobenzenebutanoic acid
• Benzenebutanoic acid, 4-butyl-α,α-dimethyl-γ-oxo-