CAS 951893-92-8
:α,α,3-Trimethyl-γ-oxo-2-thiophenebutanoic acid
Description:
α,α,3-Trimethyl-γ-oxo-2-thiophenebutanoic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and multiple methyl groups. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the γ-oxo group indicates that it contains a ketone functionality, which can influence its reactivity and interactions with other molecules. The trimethyl substituents enhance its steric bulk, potentially affecting its solubility and biological activity. This compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential applications in drug development or as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety and handling precautions should be observed when working with this substance.
Formula:C11H14O3S
InChI:InChI=1S/C11H14O3S/c1-7-4-5-15-9(7)8(12)6-11(2,3)10(13)14/h4-5H,6H2,1-3H3,(H,13,14)
InChI key:InChIKey=WUJWHQYBCLUNBC-UHFFFAOYSA-N
SMILES:C(CC(C(O)=O)(C)C)(=O)C1=C(C)C=CS1
Synonyms:- α,α,3-Trimethyl-γ-oxo-2-thiophenebutanoic acid
- 2-Thiophenebutanoic acid, α,α,3-trimethyl-γ-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.