CAS 951894-13-6

4-Bromo-1-(2-chloro-2-propen-1-yl)-2-fluorobenzene

Description:

4-Bromo-1-(2-chloro-2-propen-1-yl)-2-fluorobenzene is an organic compound characterized by its complex structure, which includes a bromine atom, a chlorine atom, and a fluorine atom attached to a benzene ring. This compound features a propenyl group, which introduces unsaturation and contributes to its reactivity. The presence of multiple halogen substituents can influence its physical and chemical properties, such as polarity, boiling point, and solubility. Typically, compounds like this may exhibit interesting reactivity patterns, including potential for electrophilic substitution reactions due to the electron-withdrawing effects of the halogens. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or materials science, depending on its specific reactivity and stability. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic chemistry. Safety and handling considerations are essential due to the presence of halogens, which can pose health risks.

Formula: C₉H₇BrClF

InChI: InChI=1S/C9H7BrClF/c1-6(11)4-7-2-3-8(10)5-9(7)12/h2-3,5H,1,4H2

InChI key: InChIKey=DVOCBANJGXSVIM-UHFFFAOYSA-N

SMILES: C(C(=C)Cl)C1=C(F)C=C(Br)C=C1

Synonyms:

• Benzene, 4-bromo-1-(2-chloro-2-propen-1-yl)-2-fluoro-
• 4-Bromo-1-(2-chloro-2-propen-1-yl)-2-fluorobenzene