CAS 95192-59-9

4-Methoxy-2,6-dinitrobenzoic acid

Description:

4-Methoxy-2,6-dinitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both methoxy and nitro groups. The presence of the methoxy group (-OCH3) at the para position and two nitro groups (-NO2) at the meta positions contributes to its unique chemical properties, including increased acidity compared to unsubstituted benzoic acid. This compound is typically a yellow crystalline solid and is known for its applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Its molecular structure influences its reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, the nitro groups can participate in reduction reactions, while the methoxy group can affect the electron density of the aromatic ring, influencing its reactivity. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks.

Formula: C₈H₆N₂O₇

InChI: InChI=1/C8H6N2O7/c1-17-4-2-5(9(13)14)7(8(11)12)6(3-4)10(15)16/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=DHLQYRJLNSXMPW-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N(=O)=O)C=C(OC)C=C1N(=O)=O

Synonyms:

• Benzoic Acid, 4-Methoxy-2,6-Dinitro-
• 4-Methoxy-2,6-dinitrobenzoic acid