CAS 95192-63-5
:2-methoxy-4,6-dinitrobenzoic acid
Description:
2-Methoxy-4,6-dinitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both methoxy and dinitro groups. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents, while the dinitro groups (-NO2) contribute to its reactivity and potential as a nitrating agent. This compound typically exhibits a yellow crystalline appearance and is known for its moderate to high stability under standard conditions. It is soluble in polar organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. The dinitro substituents can influence the compound's acidity, making it a stronger acid compared to unsubstituted benzoic acid. Additionally, 2-methoxy-4,6-dinitrobenzoic acid may be used in various chemical syntheses and research applications, particularly in the fields of organic chemistry and materials science. Safety precautions should be taken when handling this compound, as the nitro groups can pose hazards related to toxicity and environmental impact.
Formula:C8H6N2O7
InChI:InChI=1/C8H6N2O7/c1-17-6-3-4(9(13)14)2-5(10(15)16)7(6)8(11)12/h2-3H,1H3,(H,11,12)
SMILES:COc1cc(cc(c1C(=O)O)N(=O)=O)N(=O)=O
Synonyms:- Benzoic Acid, 2-Methoxy-4,6-Dinitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.