CymitQuimica logo

CAS 952-10-3

:

2,3-dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl chloride

Description:
2,3-Dioxo-1,2,3,4-tetrahydroquinoxaline-6-sulfonyl chloride, with the CAS number 952-10-3, is a chemical compound characterized by its unique structure that includes a quinoxaline core, sulfonyl chloride functional group, and two carbonyl groups. This compound typically appears as a solid and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. The presence of the dioxo groups contributes to its potential as a versatile intermediate in various chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, handling precautions should be observed due to its reactive nature and potential toxicity associated with sulfonyl chlorides. Proper storage and disposal methods are essential to ensure safety in laboratory environments.
Formula:C8H5ClN2O4S
InChI:InChI=1/C8H5ClN2O4S/c9-16(14,15)4-1-2-5-6(3-4)11-8(13)7(12)10-5/h1-3H,(H,10,12)(H,11,13)
InChI key:VJHXFHCNOUEKQY-UHFFFAOYSA-N
SMILES:c1cc2c(cc1S(=O)(=O)Cl)[nH]c(=O)c(=O)[nH]2
Synonyms:
  • 6-Quinoxalinesulfonyl Chloride, 1,2,3,4-Tetrahydro-2,3-Dioxo-
Found 6 products.