CAS 952024-31-6

N-[(3-benzyloxy-2-pyridyl)methyl]formamide

Description:

N-[(3-benzyloxy-2-pyridyl)methyl]formamide is an organic compound characterized by its unique structure, which includes a formamide functional group attached to a pyridine ring substituted with a benzyloxy group. This compound typically exhibits properties associated with both amides and aromatic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the formamide group. The benzyloxy substituent can enhance the compound's lipophilicity, potentially influencing its biological activity and interaction with various targets. Additionally, the pyridine ring contributes to the compound's aromaticity, which can affect its electronic properties and stability. The presence of the nitrogen atom in the formamide group may also impart basic characteristics, allowing for potential interactions in biological systems. Overall, N-[(3-benzyloxy-2-pyridyl)methyl]formamide is of interest in medicinal chemistry and drug design due to its structural features that may facilitate specific interactions with biological macromolecules.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1/C14H14N2O2/c17-11-15-9-13-14(7-4-8-16-13)18-10-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,15,17)

SMILES: c1ccc(cc1)COc1cccnc1CN=CO

Synonyms:

• formamide, N-[[3-(phenylmethoxy)-2-pyridinyl]methyl]-
• N-{[3-(Benzyloxy)pyridin-2-yl]methyl}formamide
• N-[(3-Benzyloxypyridin-2-yl)methyl]formamide

Formamide,n-[[3-(phenylmethoxy)-2-pyridinyl]methyl]-

CAS: 952024-31-6

Formula: C₁₄H₁₄N₂O₂

Purity: 95%

Molecular weight: 242.2732

Ref: IN-DA01E9EL