CAS 952182-01-3

4-amino-1-methylpyridin-2(1H)-one

Description:

4-Amino-1-methylpyridin-2(1H)-one, with the CAS number 952182-01-3, is a heterocyclic organic compound characterized by a pyridine ring substituted with an amino group and a methyl group. This compound features a carbonyl group adjacent to the amino group, contributing to its reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the amino and carbonyl functional groups. The compound may exhibit basic properties due to the nitrogen atoms in the pyridine and amino groups, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or metabolic pathways. Additionally, the presence of the methyl group can influence the compound's lipophilicity and overall pharmacokinetic properties. As with many organic compounds, safety data should be consulted for handling and usage.

Formula: C₆H₈N₂O

InChI: InChI=1/C6H8N2O/c1-8-3-2-5(7)4-6(8)9/h2-4H,7H2,1H3

SMILES: Cn1ccc(cc1=O)N

4-Amino-1-methylpyridin-2(1H)-one

CAS: 952182-01-3

Formula: C₆H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA003KNQ

4-Amino-1-methylpyridin-2-one

CAS: 952182-01-3

4-Amino-1-methylpyridin-2-one

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.14g/mol

Ref: 54-OR302362

4-Amino-1-methylpyridin-2(1H)-one

CAS: 952182-01-3

Formula: C₆H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 124.143

Ref: 10-F236919