CAS 952182-21-7

methyl 6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Description:

Methyl 6-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine-3-carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a trifluoromethyl group and a carboxylate ester functionality. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its potential applications in medicinal chemistry and material science. The presence of the trifluoromethyl group enhances lipophilicity and can influence biological activity, making it a subject of interest in drug development. The pyrrolopyridine framework is known for its diverse pharmacological properties, including anti-inflammatory and anticancer activities. Additionally, the methyl ester group can be hydrolyzed to yield the corresponding carboxylic acid, which may further expand its utility in synthetic chemistry. Overall, this compound's distinctive features, including its fluorinated substituent and heterocyclic ring system, position it as a valuable candidate for research in various chemical and pharmaceutical applications.

Formula: C₁₀H₇F₃N₂O₂

InChI: InChI=1/C10H7F3N2O2/c1-17-9(16)6-4-14-8-5(6)2-3-7(15-8)10(11,12)13/h2-4H,1H3,(H,14,15)

SMILES: COC(=O)c1c[nH]c2c1ccc(C(F)(F)F)n2