CAS 952182-32-0

methyl 1-(p-tolylsulfonyl)pyrrolo[3,2-b]pyridine-2-carboxylate

Description:

Methyl 1-(p-tolylsulfonyl)pyrrolo[3,2-b]pyridine-2-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrolo[3,2-b]pyridine core, a methyl ester functional group, and a p-tolylsulfonyl substituent. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as moderate to high solubility in organic solvents and potential reactivity due to the presence of functional groups. The sulfonyl group can enhance the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the pyridine ring may contribute to its basicity and potential interactions with biological targets. Methyl 1-(p-tolylsulfonyl)pyrrolo[3,2-b]pyridine-2-carboxylate may also exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental conditions and the presence of other chemical species.

Formula: C₁₆H₁₄N₂O₄S

InChI: InChI=1/C16H14N2O4S/c1-11-5-7-12(8-6-11)23(20,21)18-14-4-3-9-17-13(14)10-15(18)16(19)22-2/h3-10H,1-2H3

SMILES: Cc1ccc(cc1)S(=O)(=O)n1c2cccnc2cc1C(=O)OC

Methyl 1-(toluene-4-sulphonyl)-4-azaindole-2-carboxylate

CAS: 952182-32-0

Methyl 1-(toluene-4-sulphonyl)-4-azaindole-2-carboxylate

Purity: ≥95%

Molecular weight: 330.36g/mol

Ref: 54-OR41131