CAS 952182-44-4

2-[(3,4-Dichlorophenyl)amino]-4-thiazolecarboxylic acid

Description:

2-[(3,4-Dichlorophenyl)amino]-4-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which can significantly influence its biological activity and chemical reactivity. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on its molecular structure and the functional groups present, which can affect its behavior in biological systems. Overall, 2-[(3,4-Dichlorophenyl)amino]-4-thiazolecarboxylic acid is a complex molecule with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₀H₆Cl₂N₂O₂S

InChI: InChI=1S/C10H6Cl2N2O2S/c11-6-2-1-5(3-7(6)12)13-10-14-8(4-17-10)9(15)16/h1-4H,(H,13,14)(H,15,16)

InChI key: InChIKey=AWSZMFQURKXDAR-UHFFFAOYSA-N

SMILES: N(C1=NC(C(O)=O)=CS1)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 2-[(3,4-Dichlorophenyl)amino]-4-thiazolecarboxylic acid
• 2-((3,4-Dichlorophenyl)imino)-2,3-dihydrothiazole-4-carboxylic acid
• 2-[(3,4-Dichlorophenyl)amino]-1,3-thiazole-4-carboxylic acid
• 4-Thiazolecarboxylic acid, 2-[(3,4-dichlorophenyl)amino]-
• 2-(3,4-dichloroanilino)-1,3-thiazole-4-carboxylic acid
• 2-(3,4-dichloro-phenylamino)-thiazole-4-carboxylic acid

2-[(3,4-Dichlorophenyl)amino]-1,3-thiazole-4-carboxylic acid

CAS: 952182-44-4

2-[(3,4-Dichlorophenyl)amino]-1,3-thiazole-4-carboxylic acid

Purity: 95%

Molecular weight: 289.14g/mol

Ref: 54-OR12461