CAS 952182-48-8

1H-1,2,3-Triazole-4-carboxamide, 1-[(4-bromophenyl)methyl]-5-methyl-

Description:

1H-1,2,3-Triazole-4-carboxamide, 1-[(4-bromophenyl)methyl]-5-methyl- is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This specific triazole derivative features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a 4-bromophenylmethyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The methyl group at the 5-position of the triazole ring can also affect the compound's steric and electronic properties. Such compounds are often investigated for their pharmacological activities, including antimicrobial and anticancer properties, due to the triazole moiety's ability to mimic natural products and interact with various biological pathways. The compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular structure, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₁H₁₁BrN₄O

InChI: InChI=1S/C11H11BrN4O/c1-7-10(11(13)17)14-15-16(7)6-8-2-4-9(12)5-3-8/h2-5H,6H2,1H3,(H2,13,17)

InChI key: InChIKey=OXYZPKPDOFNAHU-UHFFFAOYSA-N

SMILES: C(N1C(C)=C(C(N)=O)N=N1)C2=CC=C(Br)C=C2

Synonyms:

• 1-[(4-Bromophenyl)methyl]-5-methyl-1H-1,2,3-triazole-4-carboxamide
• 1-[(4-Bromophenyl)methyl]-5-methyltriazole-4-carboxamide
• 1H-1,2,3-Triazole-4-carboxamide, 1-[(4-bromophenyl)methyl]-5-methyl-