CAS 952182-63-7

Isothiazolidine, 2-[4-(methylthio)phenyl]-, 1,1-dioxide

Description:

Isothiazolidine, 2-[4-(methylthio)phenyl]-, 1,1-dioxide, identified by CAS number 952182-63-7, is a heterocyclic compound featuring a five-membered ring containing both sulfur and nitrogen atoms. This compound is characterized by the presence of a methylthio group attached to a phenyl ring, which contributes to its unique chemical properties. The isothiazolidine structure typically exhibits a range of biological activities, making it of interest in pharmaceutical research. The 1,1-dioxide functional group indicates the presence of two oxygen atoms bonded to the sulfur atom, which can influence the compound's reactivity and solubility. Isothiazolidines are known for their potential applications in medicinal chemistry, particularly as antimicrobial or antifungal agents. The specific substitution pattern of this compound may also affect its interaction with biological targets, enhancing its efficacy or selectivity. Overall, the characteristics of this compound suggest it could be valuable in various chemical and biological applications, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₁₃NO₂S₂

InChI: InChI=1S/C10H13NO2S2/c1-14-10-5-3-9(4-6-10)11-7-2-8-15(11,12)13/h3-6H,2,7-8H2,1H3

InChI key: InChIKey=QOOTVYRKLYAIHA-UHFFFAOYSA-N

SMILES: O=S1(=O)N(C2=CC=C(SC)C=C2)CCC1

Synonyms:

• Isothiazolidine, 2-[4-(methylthio)phenyl]-, 1,1-dioxide