CAS 952182-70-6

3-[(5-Bromo-2-pyrimidinyl)oxy]benzaldehyde

Description:

3-[(5-Bromo-2-pyrimidinyl)oxy]benzaldehyde is an organic compound characterized by its functional groups, which include a benzaldehyde moiety and a pyrimidine ring substituted with a bromine atom. The presence of the bromine atom enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The compound features an ether linkage between the pyrimidine and the benzaldehyde, which can affect its solubility and interaction with other molecules. Typically, compounds like this may exhibit properties such as moderate to high polarity due to the presence of the polar functional groups. Its structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. Additionally, the compound's unique characteristics may allow for further derivatization, leading to a variety of analogs with potentially enhanced efficacy or selectivity in biological systems. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.

Formula: C₁₁H₇BrN₂O₂

InChI: InChI=1S/C11H7BrN2O2/c12-9-5-13-11(14-6-9)16-10-3-1-2-8(4-10)7-15/h1-7H

InChI key: InChIKey=QSWXBGNAPDVBSL-UHFFFAOYSA-N

SMILES: O(C1=CC(C=O)=CC=C1)C=2N=CC(Br)=CN2

Synonyms:

• 3-[(5-Bromo-2-pyrimidinyl)oxy]benzaldehyde
• Benzaldehyde, 3-[(5-bromo-2-pyrimidinyl)oxy]-