CAS 952182-80-8
:Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetate
Description:
Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetate, identified by its CAS number 952182-80-8, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, an aromatic phenyl group, and an ester functional group. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. The presence of the piperidine moiety suggests potential biological activity, as piperidine derivatives are often explored for their pharmacological properties. The methyl ester group indicates that the compound may exhibit moderate lipophilicity, influencing its absorption and distribution in biological systems. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could affect its reactivity and interactions with biological targets. Overall, this compound's unique structural features make it a candidate for further research in medicinal chemistry and drug development.
Formula:C19H28N2O4
InChI:InChI=1S/C19H28N2O4/c1-19(2,3)25-18(23)20-15-10-12-21(13-11-15)16(17(22)24-4)14-8-6-5-7-9-14/h5-9,15-16H,10-13H2,1-4H3,(H,20,23)
InChI key:InChIKey=ZBZCXRUKPZPMDU-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(N1CCC(NC(OC(C)(C)C)=O)CC1)C2=CC=CC=C2
Synonyms:- Methyl 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-1-piperidineacetate
- 1-Piperidineacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-phenyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.