CAS 952182-81-9
:N-Hydroxy-3-methyl-1-piperidineethanimidamide
Description:
N-Hydroxy-3-methyl-1-piperidineethanimidamide, identified by its CAS number 952182-81-9, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both amides and hydroxylamines, such as potential reactivity in organic synthesis and biological applications. The presence of the hydroxylamine group suggests it may participate in redox reactions, while the piperidine moiety can influence its solubility and interaction with biological systems. Additionally, the methyl group on the piperidine ring can affect the steric and electronic properties of the molecule, potentially enhancing its biological activity or selectivity. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Overall, N-Hydroxy-3-methyl-1-piperidineethanimidamide represents a versatile structure with implications in medicinal chemistry and synthetic organic chemistry.
Formula:C8H17N3O
InChI:InChI=1S/C8H17N3O/c1-7-3-2-4-11(5-7)6-8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10)
InChI key:InChIKey=XCWPFQBBRPXPRU-UHFFFAOYSA-N
SMILES:C(C(NO)=N)N1CC(C)CCC1
Synonyms:- 1-Piperidineethanimidamide, N-hydroxy-3-methyl-
- N-Hydroxy-3-methyl-1-piperidineethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.