CAS 952182-84-2

2-[3-(Trifluoromethoxy)phenoxy]ethanethioamide

Description:

2-[3-(Trifluoromethoxy)phenoxy]ethanethioamide, identified by its CAS number 952182-84-2, is a chemical compound characterized by its unique functional groups and structural features. It contains a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and a thioamide group, which consists of a sulfur atom bonded to a carbonyl carbon and a nitrogen atom. The presence of the trifluoromethoxy group introduces significant electronegativity and lipophilicity, influencing the compound's reactivity and solubility. This compound may exhibit biological activity due to its structural components, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the trifluoromethoxy substituent can enhance the compound's metabolic stability and bioavailability. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with its components. Further studies would be necessary to fully elucidate its properties and applications in various fields.

Formula: C₉H₈F₃NO₂S

InChI: InChI=1S/C9H8F3NO2S/c10-9(11,12)15-7-3-1-2-6(4-7)14-5-8(13)16/h1-4H,5H2,(H2,13,16)

InChI key: InChIKey=OSWPIGUFRZPHBQ-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=CC(OCC(N)=S)=CC=C1

Synonyms:

• 2-[3-(Trifluoromethoxy)phenoxy]ethanethioamide
• Ethanethioamide, 2-[3-(trifluoromethoxy)phenoxy]-