CAS 952182-88-6
:4-(4-Methoxyphenyl)isoxazolo[3,4-d]pyridazin-7(6H)-one
Description:
4-(4-Methoxyphenyl)isoxazolo[3,4-d]pyridazin-7(6H)-one is a heterocyclic compound characterized by its unique structural features, which include an isoxazole ring fused to a pyridazine moiety. This compound typically exhibits a molecular structure that incorporates a methoxyphenyl group, contributing to its potential biological activity. The presence of the isoxazole and pyridazine rings suggests that it may possess interesting pharmacological properties, potentially acting as a bioactive agent in various applications. Its molecular formula and specific functional groups can influence its solubility, stability, and reactivity, making it a subject of interest in medicinal chemistry and drug development. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Overall, 4-(4-Methoxyphenyl)isoxazolo[3,4-d]pyridazin-7(6H)-one represents a class of compounds that could be explored for their therapeutic potential, although further studies would be necessary to elucidate its specific biological effects and mechanisms of action.
Formula:C12H9N3O3
InChI:InChI=1S/C12H9N3O3/c1-17-8-4-2-7(3-5-8)10-9-6-18-15-11(9)12(16)14-13-10/h2-6H,1H3,(H,14,16)
InChI key:InChIKey=AVSDLKCPVLCUBK-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=NN1)C3=CC=C(OC)C=C3)=CON2
Synonyms:- 4-(4-Methoxyphenyl)isoxazolo[3,4-d]pyridazin-7(6H)-one
- Isoxazolo[3,4-d]pyridazin-7(6H)-one, 4-(4-methoxyphenyl)-
- 4-(4-methoxyphenyl)-6H-[1,2]oxazolo[3,4-d]pyridazin-7-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.