CAS 952182-95-5

Ethyl 4-(cyclopropylcarbonyl)-3-isoxazolecarboxylate

Description:

Ethyl 4-(cyclopropylcarbonyl)-3-isoxazolecarboxylate is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its potential biological activity. The presence of the cyclopropylcarbonyl group enhances its reactivity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the isoxazole moiety, which is often associated with various biological activities. The ethyl ester functional group may also play a role in its pharmacokinetic properties, such as absorption and metabolism. As with many organic compounds, the specific characteristics, including melting point, boiling point, and spectral data, would require empirical determination or reference to scientific literature for precise values. Overall, Ethyl 4-(cyclopropylcarbonyl)-3-isoxazolecarboxylate represents a compound of interest for further research in chemical and biological fields.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1S/C10H11NO4/c1-2-14-10(13)8-7(5-15-11-8)9(12)6-3-4-6/h5-6H,2-4H2,1H3

InChI key: InChIKey=RVVIFCSUZZBKEQ-UHFFFAOYSA-N

SMILES: C(=O)(C=1C(C(OCC)=O)=NOC1)C2CC2

Synonyms:

• Ethyl 4-(cyclopropylcarbonyl)-3-isoxazolecarboxylate
• 3-Isoxazolecarboxylic acid, 4-(cyclopropylcarbonyl)-, ethyl ester