CAS 952183-03-8
:4-Hydroxy-3-nitrobenzeneacetic acid hydrazide
Description:
4-Hydroxy-3-nitrobenzeneacetic acid hydrazide is an organic compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with a carboxylic acid. This compound features a nitro group and a hydroxyl group on a benzene ring, contributing to its potential reactivity and biological activity. The presence of the nitro group typically enhances the compound's electron-withdrawing properties, which can influence its chemical behavior and interactions. The hydrazide moiety can participate in various chemical reactions, including condensation and hydrazone formation, making it useful in synthetic organic chemistry. Additionally, compounds of this nature may exhibit pharmacological properties, potentially serving as intermediates in drug development or as active pharmaceutical ingredients. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity or reactivity.
Formula:C8H9N3O4
InChI:InChI=1S/C8H9N3O4/c9-10-8(13)4-5-1-2-7(12)6(3-5)11(14)15/h1-3,12H,4,9H2,(H,10,13)
InChI key:InChIKey=CKZMTJQJOQRMOX-UHFFFAOYSA-N
SMILES:C(C(NN)=O)C1=CC(N(=O)=O)=C(O)C=C1
Synonyms:- Benzeneacetic acid, 4-hydroxy-3-nitro-, hydrazide
- 4-Hydroxy-3-nitrobenzeneacetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.