CAS 952183-06-1

Ethyl 2-[(1,1-dimethylethoxy)carbonyl]tetrahydro-1-pyridazineacetate

Description:

Ethyl 2-[(1,1-dimethylethoxy)carbonyl]tetrahydro-1-pyridazineacetate is a chemical compound characterized by its complex structure, which includes a pyridazine ring and an ethyl ester functional group. This compound features a tetrahydro-pyridazine moiety, indicating that it contains a saturated six-membered ring with nitrogen atoms, contributing to its unique chemical properties. The presence of the 1,1-dimethylethoxycarbonyl group suggests that it has sterically bulky substituents, which can influence its reactivity and solubility. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the ethyl ester and the bulky substituents, making them potentially useful in medicinal chemistry and organic synthesis. Additionally, the presence of multiple functional groups may allow for various chemical transformations, enhancing its utility in synthetic applications. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied.

Formula: C₁₃H₂₄N₂O₄

InChI: InChI=1S/C13H24N2O4/c1-5-18-11(16)10-14-8-6-7-9-15(14)12(17)19-13(2,3)4/h5-10H2,1-4H3

InChI key: InChIKey=IGRWWVVKROCJOT-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)N1N(C(OC(C)(C)C)=O)CCCC1

Synonyms:

• 1-Pyridazineacetic acid, 2-[(1,1-dimethylethoxy)carbonyl]tetrahydro-, ethyl ester
• Ethyl 2-[(1,1-dimethylethoxy)carbonyl]tetrahydro-1-pyridazineacetate