CAS 952183-08-3

2-(2-Chloro-4-fluorophenoxy)ethanethioamide

Description:

2-(2-Chloro-4-fluorophenoxy)ethanethioamide is a chemical compound characterized by its unique structure, which includes a phenoxy group substituted with chlorine and fluorine atoms, as well as a thioamide functional group. The presence of the chloro and fluoro substituents on the aromatic ring can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and altering its interaction with biological targets. The thioamide group contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry. This compound may exhibit specific properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity with nucleophiles due to the electrophilic nature of the carbonyl carbon in the thioamide. Its applications could span various fields, including pharmaceuticals and agrochemicals, depending on its biological activity and efficacy. As with any chemical substance, safety data and handling precautions should be considered, particularly due to the presence of halogenated groups.

Formula: C₈H₇ClFNOS

InChI: InChI=1S/C8H7ClFNOS/c9-6-3-5(10)1-2-7(6)12-4-8(11)13/h1-3H,4H2,(H2,11,13)

InChI key: InChIKey=XREVONDNEQDDQV-UHFFFAOYSA-N

SMILES: O(CC(N)=S)C1=C(Cl)C=C(F)C=C1

Synonyms:

• Ethanethioamide, 2-(2-chloro-4-fluorophenoxy)-
• 2-(2-Chloro-4-fluorophenoxy)ethanethioamide