CAS 952183-09-4

Ethyl 4-(4-phenoxybenzoyl)-3-isoxazolecarboxylate

Description:

Ethyl 4-(4-phenoxybenzoyl)-3-isoxazolecarboxylate is a chemical compound characterized by its unique structure, which includes an isoxazole ring and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in pharmaceuticals and organic synthesis. The presence of the phenoxy and benzoyl groups suggests that it may have interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Its isoxazole moiety may also impart biological activity, making it a candidate for further investigation in medicinal chemistry. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and pH. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment. Overall, Ethyl 4-(4-phenoxybenzoyl)-3-isoxazolecarboxylate represents a versatile structure with potential utility in various chemical and biological applications.

Formula: C₁₉H₁₅NO₅

InChI: InChI=1S/C19H15NO5/c1-2-23-19(22)17-16(12-24-20-17)18(21)13-8-10-15(11-9-13)25-14-6-4-3-5-7-14/h3-12H,2H2,1H3

InChI key: InChIKey=BYSJNELHRVBXLK-UHFFFAOYSA-N

SMILES: C(=O)(C=1C(C(OCC)=O)=NOC1)C2=CC=C(OC3=CC=CC=C3)C=C2

Synonyms:

• 3-Isoxazolecarboxylic acid, 4-(4-phenoxybenzoyl)-, ethyl ester
• Ethyl 4-(4-phenoxybenzoyl)-3-isoxazolecarboxylate