CymitQuimica logo

CAS 952183-14-1

:

4-(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)benzoic acid hydrazide

Description:
4-(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)benzoic acid hydrazide, with the CAS number 952183-14-1, is a chemical compound characterized by its unique structural features, which include a hydrazide functional group and a benzodioxepin moiety. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide group. The benzodioxepin structure may contribute to its stability and influence its solubility in various solvents. Additionally, compounds of this nature may possess biological activity, making them of interest in medicinal chemistry and drug development. The presence of multiple functional groups suggests that it could engage in diverse chemical interactions, which may be explored for various applications, including pharmaceuticals. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C16H16N2O3
InChI:InChI=1S/C16H16N2O3/c17-18-16(19)12-4-2-11(3-5-12)13-6-7-14-15(10-13)21-9-1-8-20-14/h2-7,10H,1,8-9,17H2,(H,18,19)
InChI key:InChIKey=PMKGRXVEIAIQCO-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC=C(C=2C=C3C(=CC2)OCCCO3)C=C1
Synonyms:
  • 4-(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)benzoic acid hydrazide
  • Benzoic acid, 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.