CAS 952183-34-5
:N-(2-Hydroxyethyl)-4-(1H-imidazol-1-yl)benzamide
Description:
N-(2-Hydroxyethyl)-4-(1H-imidazol-1-yl)benzamide, identified by its CAS number 952183-34-5, is a chemical compound characterized by its unique structural features, which include a benzamide core substituted with a hydroxyethyl group and an imidazole ring. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyethyl group, which can engage in hydrogen bonding. The imidazole moiety may contribute to biological activity, potentially interacting with various biological targets, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may possess both hydrophilic and lipophilic characteristics, influencing its behavior in biological systems. Additionally, the presence of functional groups such as the hydroxyl and amide groups may enhance its reactivity and stability under certain conditions. Overall, N-(2-Hydroxyethyl)-4-(1H-imidazol-1-yl)benzamide is a compound with potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c16-8-6-14-12(17)10-1-3-11(4-2-10)15-7-5-13-9-15/h1-5,7,9,16H,6,8H2,(H,14,17)
InChI key:InChIKey=IVCZEZZYMPELQR-UHFFFAOYSA-N
SMILES:C(NCCO)(=O)C1=CC=C(C=C1)N2C=CN=C2
Synonyms:- Benzamide, N-(2-hydroxyethyl)-4-(1H-imidazol-1-yl)-
- N-(2-Hydroxyethyl)-4-(1H-imidazol-1-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.