CAS 952183-38-9

1,5-Dihydro-1,3-dimethyl-8-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione

Description:

1,5-Dihydro-1,3-dimethyl-8-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione, with CAS number 952183-38-9, is a heterocyclic compound characterized by a fused pyridine and pyrimidine structure. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of two carbonyl groups in the pyrimidine ring contributes to its reactivity and stability. The dimethyl substitutions enhance its solubility and may affect its interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of novel therapeutic agents. Its unique structural features may also provide insights into its mechanism of action and biological efficacy. As with many heterocycles, the electronic properties imparted by the nitrogen atoms and functional groups can lead to diverse reactivity patterns, making it a valuable subject for further research in both synthetic and medicinal chemistry.

Formula: C₁₀H₈F₃N₃O₃

InChI: InChI=1S/C10H8F3N3O3/c1-15-7-4(10(11,12)13)3-5(17)14-6(7)8(18)16(2)9(15)19/h3H,1-2H3,(H,14,17)

InChI key: InChIKey=DMTVWBHUOAKNSL-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C(=O)N(C)C(=O)N2C)NC(=O)C1

Synonyms:

• 1,5-Dihydro-1,3-dimethyl-8-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione
• Pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione, 1,5-dihydro-1,3-dimethyl-8-(trifluoromethyl)-

1,5-Dihydro-1,3-dimethyl-8-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione

CAS: 952183-38-9

1,5-Dihydro-1,3-dimethyl-8-(trifluoromethyl)pyrido[3,2-d]pyrimidine-2,4,6(3H)-trione

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 275.18g/mol

Ref: 54-PC7217