CAS 952183-58-3
:1-[2-[(4-Ethylphenyl)amino]-5-thiazolyl]ethanone
Description:
1-[2-[(4-Ethylphenyl)amino]-5-thiazolyl]ethanone, identified by its CAS number 952183-58-3, is an organic compound characterized by its thiazole and ketone functional groups. The thiazole ring contributes to its heterocyclic nature, which often imparts unique chemical reactivity and biological activity. The presence of the 4-ethylphenyl group suggests potential hydrophobic interactions, influencing its solubility and interaction with biological targets. This compound may exhibit properties typical of thiazole derivatives, such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure indicates the potential for various substitution patterns, which can affect its pharmacokinetics and pharmacodynamics. Additionally, the compound's stability, reactivity, and potential applications in drug development or as a chemical probe can be influenced by the specific arrangement of its functional groups. Overall, 1-[2-[(4-Ethylphenyl)amino]-5-thiazolyl]ethanone represents a class of compounds that may hold promise in various chemical and biological applications.
Formula:C13H14N2OS
InChI:InChI=1S/C13H14N2OS/c1-3-10-4-6-11(7-5-10)15-13-14-8-12(17-13)9(2)16/h4-8H,3H2,1-2H3,(H,14,15)
InChI key:InChIKey=QYELBLGFCXDABS-UHFFFAOYSA-N
SMILES:N(C=1SC(C(C)=O)=CN1)C2=CC=C(CC)C=C2
Synonyms:- 1-[2-[(4-Ethylphenyl)amino]-5-thiazolyl]ethanone
- Ethanone, 1-[2-[(4-ethylphenyl)amino]-5-thiazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.