CymitQuimica logo

CAS 952183-59-4

:

1-[2-[(2,5-Dimethoxyphenyl)amino]-5-thiazolyl]ethanone

Description:
1-[2-[(2,5-Dimethoxyphenyl)amino]-5-thiazolyl]ethanone, identified by its CAS number 952183-59-4, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a dimethoxy-substituted phenyl group. This compound typically exhibits properties associated with both thiazole and aromatic amine functionalities, potentially influencing its reactivity and biological activity. The presence of the ethanone moiety suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. Additionally, the dimethoxy groups can enhance lipophilicity and influence the compound's solubility in organic solvents. The thiazole ring often contributes to the compound's pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest potential applications in drug development and other fields of chemistry, although specific biological activities would require further investigation.
Formula:C13H14N2O3S
InChI:InChI=1S/C13H14N2O3S/c1-8(16)12-7-14-13(19-12)15-10-6-9(17-2)4-5-11(10)18-3/h4-7H,1-3H3,(H,14,15)
InChI key:InChIKey=FZCULTVCNUDOTH-UHFFFAOYSA-N
SMILES:N(C1=C(OC)C=CC(OC)=C1)C=2SC(C(C)=O)=CN2
Synonyms:
  • Ethanone, 1-[2-[(2,5-dimethoxyphenyl)amino]-5-thiazolyl]-
  • 1-[2-[(2,5-Dimethoxyphenyl)amino]-5-thiazolyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.