CAS 952183-70-9

1-[2-[(5-Chloro-2-pyridinyl)amino]-4-methyl-5-thiazolyl]ethanone

Description:

1-[2-[(5-Chloro-2-pyridinyl)amino]-4-methyl-5-thiazolyl]ethanone, with the CAS number 952183-70-9, is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyridine moiety, and an ethanone functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen and sulfur atoms in its rings. The chloro substituent on the pyridine ring may influence its reactivity and solubility, while the thiazole component can contribute to its pharmacological properties. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly as pharmaceuticals or agrochemicals. The presence of multiple functional groups suggests that it may engage in various chemical reactions, including nucleophilic substitutions or coordination with metal ions. Overall, this compound's unique structural features make it a subject of interest in both synthetic and applied chemistry contexts.

Formula: C₁₁H₁₀ClN₃OS

InChI: InChI=1S/C11H10ClN3OS/c1-6-10(7(2)16)17-11(14-6)15-9-4-3-8(12)5-13-9/h3-5H,1-2H3,(H,13,14,15)

InChI key: InChIKey=AZOFXCSDLOLYGF-UHFFFAOYSA-N

SMILES: N(C=1SC(C(C)=O)=C(C)N1)C2=CC=C(Cl)C=N2

Synonyms:

• 1-[2-[(5-Chloro-2-pyridinyl)amino]-4-methyl-5-thiazolyl]ethanone
• Ethanone, 1-[2-[(5-chloro-2-pyridinyl)amino]-4-methyl-5-thiazolyl]-
• 1-{2-[(5-chloro-2-pyridinyl)amino]-4-methyl-1,3-thiazol-5-yl}-1-ethanone
• 1-[2-[(5-chloropyridin-2-yl)amino]-4-methyl-1,3-thiazol-5-yl]ethanone

5-Acetyl-2-[(5-chloropyridin-2-yl)amino]-4-methyl-1,3-thiazole

CAS: 952183-70-9

5-Acetyl-2-[(5-chloropyridin-2-yl)amino]-4-methyl-1,3-thiazole

Purity: 95%

Molecular weight: 267.73g/mol

Ref: 54-OR12485